EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H64N2 |
| Net Charge | 0 |
| Average Mass | 596.988 |
| Monoisotopic Mass | 596.50695 |
| SMILES | [H][C@@]12CCc3cc(C(C)C)ccc3[C@@]1(C)CCC[C@@]2(C)CNCCNC[C@]1(C)CCC[C@]2(C)c3ccc(C(C)C)cc3CC[C@@]12[H] |
| InChI | InChI=1S/C42H64N2/c1-29(2)31-11-15-35-33(25-31)13-17-37-39(5,19-9-21-41(35,37)7)27-43-23-24-44-28-40(6)20-10-22-42(8)36-16-12-32(30(3)4)26-34(36)14-18-38(40)42/h11-12,15-16,25-26,29-30,37-38,43-44H,9-10,13-14,17-24,27-28H2,1-8H3/t37-,38-,39-,40-,41+,42+/m0/s1 |
| InChIKey | XGIHQYAWBCFNPY-AZOCGYLKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydrabamine (CHEBI:52166) is a diamine (CHEBI:23666) |
| hydrabamine (CHEBI:52166) is conjugate base of hydrabamine(1+) (CHEBI:52170) |
| Incoming Relation(s) |
| hydrabamine dihydrochloride (CHEBI:52167) has part hydrabamine (CHEBI:52166) |
| hydrabamine(1+) (CHEBI:52170) is conjugate acid of hydrabamine (CHEBI:52166) |
| IUPAC Name |
|---|
| N,N'-di[abieta-8(14),9(11),12-trien-18-yl]ethane-1,2-diamine |
| Registry Numbers | Sources |
|---|---|
| CAS:125-92-8 | Beilstein |