EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H24O12 |
| Net Charge | 0 |
| Average Mass | 516.455 |
| Monoisotopic Mass | 516.12678 |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)O[C@H]1C[C@@](O)(C(=O)O)C[C@@H](OC(=O)/C=C/c2ccc(O)c(O)c2)[C@@H]1O |
| InChI | InChI=1S/C25H24O12/c26-15-5-1-13(9-17(15)28)3-7-21(30)36-19-11-25(35,24(33)34)12-20(23(19)32)37-22(31)8-4-14-2-6-16(27)18(29)10-14/h1-10,19-20,23,26-29,32,35H,11-12H2,(H,33,34)/b7-3+,8-4+/t19-,20+,23+,25- |
| InChIKey | KRZBCHWVBQOTNZ-KZIMDKONSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5-di-O-caffeoyl-muco-quinic acid (CHEBI:521393) is a cyclitol carboxylic acid (CHEBI:36123) |
| IUPAC Name |
|---|
| (3R,5S)-3,5-bis{[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}-1,4-dihydroxycyclohexanecarboxylic acid |
| Synonym | Source |
|---|---|
| 3,5-di-O-caffeoyl-muco-quinic acid | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7399519 | Beilstein |
| Citations |
|---|