EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30F6N2O2 |
| Net Charge | 0 |
| Average Mass | 528.537 |
| Monoisotopic Mass | 528.22115 |
| SMILES | [H][C@@]12CC[C@@]3([H])NC(=O)C=C[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])C(=O)Nc1cc(C(F)(F)F)ccc1C(F)(F)F |
| InChI | InChI=1S/C27H30F6N2O2/c1-24-11-9-17-15(4-8-21-25(17,2)12-10-22(36)35-21)16(24)6-7-19(24)23(37)34-20-13-14(26(28,29)30)3-5-18(20)27(31,32)33/h3,5,10,12-13,15-17,19,21H,4,6-9,11H2,1-2H3,(H,34,37)(H,35,36)/t15-,16-,17-,19+,21+,24-,25+/m0/s1 |
| InChIKey | JWJOTENAMICLJG-QWBYCMEYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 1.3.1.22 [3-oxo-5alpha-steroid 4-dehydrogenase (NADP(+))] inhibitor An EC 1.3.1.* (oxidoreductase acting on CH-CH group of donor, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of of 3-oxo-5α-steroid 4-dehydrogenase (NADP+), EC 1.3.1.22, the enzyme which converts testosterone (CHEBI:17347) into the more potent androgen 5α-dihydrotestosterone. |
| Application: | antihyperplasia drug A drug used for the treatment of hyperplasia (increaced cell production within an organ or tissue). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dutasteride (CHEBI:521033) has parent hydride 5α-androstane (CHEBI:28859) |
| dutasteride (CHEBI:521033) has role antihyperplasia drug (CHEBI:59844) |
| dutasteride (CHEBI:521033) has role EC 1.3.1.22 [3-oxo-5α-steroid 4-dehydrogenase (NADP+)] inhibitor (CHEBI:50781) |
| dutasteride (CHEBI:521033) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| dutasteride (CHEBI:521033) is a aza-steroid (CHEBI:35726) |
| dutasteride (CHEBI:521033) is a δ-lactam (CHEBI:77727) |
| IUPAC Name |
|---|
| N-[2,5-bis(trifluoromethyl)phenyl]-3-oxo-4-aza-5α-androst-1-ene-17β-carboxamide |
| Synonyms | Source |
|---|---|
| (5α,17β)-N-(2,5-bis(trifluoromethyl)phenyl)-3-oxo-4-azaandrost-1-ene-17-carboxamide | ChemIDplus |
| α,α,α,α',α',α'-hexafluoro-3-oxo-4-aza-5α-androst-1-ene-17β-carboxy-2',5'-xylidide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 973 | DrugCentral |
| D03820 | KEGG DRUG |
| DB01126 | DrugBank |
| Dutasteride | Wikipedia |
| WO9507927 | Patent |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7401530 | Beilstein |
| CAS:164656-23-9 | ChemIDplus |