EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15NO2 |
| Net Charge | 0 |
| Average Mass | 193.246 |
| Monoisotopic Mass | 193.11028 |
| SMILES | CCCCNc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C11H15NO2/c1-2-3-8-12-10-6-4-9(5-7-10)11(13)14/h4-7,12H,2-3,8H2,1H3,(H,13,14) |
| InChIKey | YCCRFDDXAVMSLM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(butylamino)benzoic acid (CHEBI:521021) is a aromatic amino acid (CHEBI:33856) |
| Incoming Relation(s) |
| benzonatate (CHEBI:3032) has functional parent 4-(butylamino)benzoic acid (CHEBI:521021) |
| IUPAC Name |
|---|
| 4-(butylamino)benzoic acid |
| Synonyms | Source |
|---|---|
| 4-n-butylaminobenzoic acid | ChemIDplus |
| 4-(N-butylamino)benzoic acid | ChEBI |
| butyl-para-aminobenzoic acid | ChEMBL |
| p-(butylamino)benzoic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2803521 | Beilstein |
| CAS:4740-24-3 | ChemIDplus |
| Citations |
|---|