EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H53NO11 |
| Net Charge | 0 |
| Average Mass | 603.750 |
| Monoisotopic Mass | 603.36186 |
| SMILES | CCCCNc1ccc(C(=O)OCCOCCOCCOCCOCCOCCOCCOCCOCCOC)cc1 |
| InChI | InChI=1S/C30H53NO11/c1-3-4-9-31-29-7-5-28(6-8-29)30(32)42-27-26-41-25-24-40-23-22-39-21-20-38-19-18-37-17-16-36-15-14-35-13-12-34-11-10-33-2/h5-8,31H,3-4,9-27H2,1-2H3 |
| InChIKey | MAFMQEKGGFWBAB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | anaesthetic Substance which produces loss of feeling or sensation. antitussive An agent that suppresses cough. Antitussives have a central or a peripheral action on the cough reflex, or a combination of both. Compare with expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing, and mucolytics, which decrease the viscosity of mucus, facilitating its removal by ciliary action and expectoration. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzonatate (CHEBI:3032) has functional parent 4-(butylamino)benzoic acid (CHEBI:521021) |
| benzonatate (CHEBI:3032) has functional parent nonaethylene glycol monomethyl ether (CHEBI:59168) |
| benzonatate (CHEBI:3032) has role anaesthetic (CHEBI:38867) |
| benzonatate (CHEBI:3032) has role antitussive (CHEBI:51177) |
| benzonatate (CHEBI:3032) is a benzoate ester (CHEBI:36054) |
| benzonatate (CHEBI:3032) is a secondary amino compound (CHEBI:50995) |
| benzonatate (CHEBI:3032) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 2,5,8,11,14,17,20,23,26-nonaoxaoctacosan-28-yl 4-(butylamino)benzoate |
| INNs | Source |
|---|---|
| benzonatate | KEGG DRUG |
| benzonatato | DrugBank |
| benzonatatum | DrugBank |
| Synonyms | Source |
|---|---|
| 2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-butylaminobenzoate | DrugBank |
| 2,5,8,11,14,17,20,23,26-nonaoxaoctacosan-28-yl p-(butylamino)benzoate | ChEBI |
| 3,6,9,12,15,18,21,24,27-nonaoxaoctacosyl 4-butylaminobenzoate | ChEBI |
| 4-(butylamino)benzoic acid 3,6,9,12,15,18,21,24,27-nonaoxaoctacos-1-yl ester | ChEBI |
| benzononatine | ChemIDplus |
| p-butylaminobenzoic acid ω-O-methylnonaethyleneglycol ester | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Benzonatate | Wikipedia |
| D00242 | KEGG DRUG |
| DB00868 | DrugBank |
| HMDB0015006 | HMDB |
| LSM-4052 | LINCS |
| US2714608 | Patent |
| WO2012054067 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6897154 | Reaxys |
| CAS:104-31-4 | KEGG DRUG |
| CAS:104-31-4 | ChemIDplus |
| Citations |
|---|