EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H24N6O |
| Net Charge | 0 |
| Average Mass | 424.508 |
| Monoisotopic Mass | 424.20116 |
| SMILES | CN1CCN(c2ccc3nc(-c4ccc5nc(-c6ccc(O)cc6)nc5c4)nc3c2)CC1 |
| InChI | InChI=1S/C25H24N6O/c1-30-10-12-31(13-11-30)18-5-9-21-23(15-18)29-25(27-21)17-4-8-20-22(14-17)28-24(26-20)16-2-6-19(32)7-3-16/h2-9,14-15,32H,10-13H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | INAAIJLSXJJHOZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | anthelminthic drug Substance intended to kill parasitic worms (helminths). fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pibenzimol (CHEBI:52082) has role anthelminthic drug (CHEBI:35443) |
| pibenzimol (CHEBI:52082) has role fluorochrome (CHEBI:51217) |
| pibenzimol (CHEBI:52082) is a N-methylpiperazine (CHEBI:46920) |
| pibenzimol (CHEBI:52082) is a bibenzimidazole (CHEBI:46884) |
| Incoming Relation(s) |
| 2'-(4-ethoxyphenyl)-5-(4-methylpiperazin-1-yl)-2,5'-bibenzimidazole (CHEBI:51232) has functional parent pibenzimol (CHEBI:52082) |
| IUPAC Name |
|---|
| 4-[5-(4-methylpiperazin-1-yl)-1H,1'H-2,5'-bibenzimidazol-2'-yl]phenol |
| Synonyms | Source |
|---|---|
| 4-(5-(4-Methyl-1-piperazinyl)(2,5'-bi-1H-benzimidazol)-2'-yl)phenol | ChemIDplus |
| Bisbenzimidazole | ChemIDplus |
| Hoe-33258 | ChemIDplus |
| HOECHST 33258 | ChEBI |
| p-(5-(5-(4-Methyl-1-piperazinyl)-2-benzimidazolyl)-2-benzimidazolyl)phenol | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6355761 | Beilstein |
| CAS:23491-44-3 | ChemIDplus |