EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H28N6O |
| Net Charge | 0 |
| Average Mass | 452.562 |
| Monoisotopic Mass | 452.23246 |
| SMILES | CCOc1ccc(-c2nc3ccc(-c4nc5ccc(N6CCN(C)CC6)cc5n4)cc3n2)cc1 |
| InChI | InChI=1S/C27H28N6O/c1-3-34-21-8-4-18(5-9-21)26-28-22-10-6-19(16-24(22)30-26)27-29-23-11-7-20(17-25(23)31-27)33-14-12-32(2)13-15-33/h4-11,16-17H,3,12-15H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | PRDFBSVERLRRMY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2'-(4-ethoxyphenyl)-5-(4-methylpiperazin-1-yl)-2,5'-bibenzimidazole (CHEBI:51232) has functional parent pibenzimol (CHEBI:52082) |
| 2'-(4-ethoxyphenyl)-5-(4-methylpiperazin-1-yl)-2,5'-bibenzimidazole (CHEBI:51232) has role fluorochrome (CHEBI:51217) |
| 2'-(4-ethoxyphenyl)-5-(4-methylpiperazin-1-yl)-2,5'-bibenzimidazole (CHEBI:51232) is a N-methylpiperazine (CHEBI:46920) |
| 2'-(4-ethoxyphenyl)-5-(4-methylpiperazin-1-yl)-2,5'-bibenzimidazole (CHEBI:51232) is a bibenzimidazole (CHEBI:46884) |
| IUPAC Name |
|---|
| 2'-(4-ethoxyphenyl)-5-(4-methylpiperazin-1-yl)-1H,1'H-2,5'-bibenzimidazole |
| Synonyms | Source |
|---|---|
| 2'-(4-ethoxyphenyl)-5-(4-methyl-1-piperazinyl)-2,5'-bi-1H-benzimidazole | ChemIDplus |
| 2'-(4-ETHOXYPHENYL)-5-(4-METHYL-1-PIPERAZINYL)-2,5'-BI-BENZIMIDAZOLE | PDBeChem |
| 2'-(p-ethoxyphenyl)-5-(4-methyl-1-piperazinyl)-2,5'-bibenzimidazole | ChemIDplus |
| bisbenzimide | ChemIDplus |
| Hoe 33342 | KEGG COMPOUND |
| Hoechst 33342 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1234011 | Beilstein |
| CAS:23491-52-3 | KEGG COMPOUND |
| CAS:23491-52-3 | ChemIDplus |