EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18N3O4S |
| Net Charge | -1 |
| Average Mass | 360.415 |
| Monoisotopic Mass | 360.10235 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)[O-])N1C(=O)[C@H]2NC(=O)[C@H](N=C)c1ccccc1 |
| InChI | InChI=1S/C17H19N3O4S/c1-17(2)12(16(23)24)20-14(22)11(15(20)25-17)19-13(21)10(18-3)9-7-5-4-6-8-9/h4-8,10-12,15H,3H2,1-2H3,(H,19,21)(H,23,24)/p-1/t10-,11-,12+,15-/m1/s1 |
| InChIKey | FZECHKJQHUVANE-MCYUEQNJSA-M |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metampicillin(1−) (CHEBI:52062) is a penicillinate anion (CHEBI:51356) |
| metampicillin(1−) (CHEBI:52062) is conjugate base of metampicillin (CHEBI:52060) |
| Incoming Relation(s) |
| metampicillin sodium (CHEBI:52063) has part metampicillin(1−) (CHEBI:52062) |
| metampicillin (CHEBI:52060) is conjugate acid of metampicillin(1−) (CHEBI:52062) |
| IUPAC Name |
|---|
| 6β-[(2R)-2-(methylideneamino)-2-phenylacetamido]-2,2-dimethylpenam-3α-carboxylate |
| Synonyms | Source |
|---|---|
| (2S,5R,6R)-3,3-dimethyl-6-{[(2R)-2-(methylideneamino)-2-phenylacetyl]amino}-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate | IUPAC |
| 6β-[(2R)-2-(methylideneamino)-2-phenylacetamido]penicillanate | ChEBI |