EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:52060 - metampicillin
| Formula | C17H19N3O4S |
| Net Charge | 0 |
| Average Mass | 361.423 |
| Monoisotopic Mass | 361.10963 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)O)N1C(=O)[C@H]2NC(=O)[C@H](N=C)c1ccccc1 |
| InChI | InChI=1S/C17H19N3O4S/c1-17(2)12(16(23)24)20-14(22)11(15(20)25-17)19-13(21)10(18-3)9-7-5-4-6-8-9/h4-8,10-12,15H,3H2,1-2H3,(H,19,21)(H,23,24)/t10-,11-,12+,15-/m1/s1 |
| InChIKey | FZECHKJQHUVANE-MCYUEQNJSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metampicillin (CHEBI:52060) is a penicillin (CHEBI:17334) |
| metampicillin (CHEBI:52060) is a penicillin allergen (CHEBI:88187) |
| metampicillin (CHEBI:52060) is conjugate acid of metampicillin(1−) (CHEBI:52062) |
| Incoming Relation(s) |
| metampicillin(1−) (CHEBI:52062) is conjugate base of metampicillin (CHEBI:52060) |
| IUPAC Name |
|---|
| 6β-[(2R)-2-(methylideneamino)-2-phenylacetamido]-2,2-dimethylpenam-3α-carboxylic acid |
| INN | Source |
|---|---|
| metampicillin | KEGG DRUG |
| Synonyms | Source |
|---|---|
| (2S,5R,6R)-3,3-dimethyl-6-{[(2R)-2-(methylideneamino)-2-phenylacetyl]amino}-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | IUPAC |
| 6β-[(2R)-2-(methylideneamino)-2-phenylacetamido]penicillanic acid | ChEBI |
| Citations |
|---|