EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O4 |
| Net Charge | 0 |
| Average Mass | 270.284 |
| Monoisotopic Mass | 270.08921 |
| SMILES | COc1cc(O)ccc1C(=O)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C16H14O4/c1-20-16-10-13(18)7-8-14(16)15(19)9-4-11-2-5-12(17)6-3-11/h2-10,17-18H,1H3/b9-4+ |
| InChIKey | PACBGANPVNHGNP-RUDMXATFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caesalpinia sappan (ncbitaxon:483143) | heartwood (PO:0004512) | PubMed (21800859) | Methanolic extract of dried heart wood of C.sappan(Caesalpinia001) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2'-O-methylisoliquiritigenin (CHEBI:519567) has functional parent isoliquiritigenin (CHEBI:310312) |
| 2'-O-methylisoliquiritigenin (CHEBI:519567) has role metabolite (CHEBI:25212) |
| 2'-O-methylisoliquiritigenin (CHEBI:519567) is a chalcones (CHEBI:23086) |
| 2'-O-methylisoliquiritigenin (CHEBI:519567) is a monomethoxybenzene (CHEBI:25235) |
| 2'-O-methylisoliquiritigenin (CHEBI:519567) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (2E)-1-(4-hydroxy-2-methoxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one |
| Synonym | Source |
|---|---|
| 4,4'-dihydroxy-2'-methoxychalcone | ChEMBL |
| UniProt Name | Source |
|---|---|
| 2'-O-methylisoliquiritigenin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00006927 | KNApSAcK |
| C15531 | KEGG COMPOUND |
| LMPK12120098 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3060129 | Reaxys |