EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H17N3O4S.H2O |
| Net Charge | 0 |
| Average Mass | 317.367 |
| Monoisotopic Mass | 317.10454 |
| SMILES | [H]C(=N)NCCSC1=C(C(=O)O)N2C(=O)[C@]([H])([C@@H](C)O)[C@@]2([H])C1.[H]O[H] |
| InChI | InChI=1S/C12H17N3O4S.H2O/c1-6(16)9-7-4-8(20-3-2-14-5-13)10(12(18)19)15(7)11(9)17;/h5-7,9,16H,2-4H2,1H3,(H2,13,14)(H,18,19);1H2/t6-,7-,9-;/m1./s1 |
| InChIKey | GSOSVVULSKVSLQ-JJVRHELESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| imipenem hydrate (CHEBI:51799) has part imipenem (CHEBI:471744) |
| imipenem hydrate (CHEBI:51799) is a carbapenems (CHEBI:46633) |
| IUPAC Name |
|---|
| (5R,6S)-6-[(1R)-1-hydroxyethyl]-3-({2-[(iminomethyl)amino]ethyl}sulfanyl)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid—water (1/1) |
| INN | Source |
|---|---|
| imipenem | ChemIDplus |
| Synonym | Source |
|---|---|
| N-formimidoyl thienamycin monohydrate | Patent |
| Manual Xrefs | Databases |
|---|---|
| EP6639 | Patent |
| IE48356 | Patent |
| Imipenem | Wikipedia |
| JP55009090 | Patent |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8174596 | Beilstein |
| CAS:74431-23-5 | ChemIDplus |