EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:471744 - imipenem
| Formula | C12H17N3O4S |
| Net Charge | 0 |
| Average Mass | 299.352 |
| Monoisotopic Mass | 299.09398 |
| SMILES | [H]C(=N)NCCSC1=C(C(=O)O)N2C(=O)[C@]([H])([C@@H](C)O)[C@@]2([H])C1 |
| InChI | InChI=1S/C12H17N3O4S/c1-6(16)9-7-4-8(20-3-2-14-5-13)10(12(18)19)15(7)11(9)17/h5-7,9,16H,2-4H2,1H3,(H2,13,14)(H,18,19)/t6-,7-,9-/m1/s1 |
| InChIKey | ZSKVGTPCRGIANV-ZXFLCMHBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| imipenem (CHEBI:471744) has role antibacterial drug (CHEBI:36047) |
| imipenem (CHEBI:471744) is a carbapenems (CHEBI:46633) |
| imipenem (CHEBI:471744) is a β-lactam antibiotic allergen (CHEBI:88225) |
| imipenem (CHEBI:471744) is tautomer of imipenem zwitterion (CHEBI:190509) |
| Incoming Relation(s) |
| imipenem hydrate (CHEBI:51799) has part imipenem (CHEBI:471744) |
| imipenem zwitterion (CHEBI:190509) is tautomer of imipenem (CHEBI:471744) |
| IUPAC Name |
|---|
| (5R,6S)-6-[(1R)-1-hydroxyethyl]-3-({2-[(iminomethyl)amino]ethyl}sulfanyl)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| Imipenem | KEGG COMPOUND |
| Imipenem anhydrous | KEGG COMPOUND |
| N-formimidoylthienamycin | ChemIDplus |
| imipenemum | ChemIDplus |
| N-formimidoyl thienamycin | Patent |
| (5R,6S)-3-(2-Formimidoylamino-ethylsulfanyl)-6-((R)-1-hydroxy-ethyl)-7-oxo-1-aza-bicyclo[3.2.0]hept-2-ene-2-carboxylic acid | ChEMBL |
| Citations |
|---|