EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14NO5S |
| Net Charge | -1 |
| Average Mass | 284.313 |
| Monoisotopic Mass | 284.05982 |
| SMILES | [H][C@]1(C2=C(C(=O)[O-])N3C(=O)[C@]([H])([C@@H](C)O)[C@@]3([H])S2)CCCO1 |
| InChI | InChI=1S/C12H15NO5S/c1-5(14)7-10(15)13-8(12(16)17)9(19-11(7)13)6-3-2-4-18-6/h5-7,11,14H,2-4H2,1H3,(H,16,17)/p-1/t5-,6-,7+,11-/m1/s1 |
| InChIKey | HGGAKXAHAYOLDJ-FHZUQPTBSA-M |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6α-[(R)-1-hydroxyethyl]-2-[(R)-tetrahydrofuran-2-yl]pen-2-em-3-carboxylate (CHEBI:51795) is a faropenem(1−) (CHEBI:51791) |
| 6α-[(R)-1-hydroxyethyl]-2-[(R)-tetrahydrofuran-2-yl]pen-2-em-3-carboxylate (CHEBI:51795) is conjugate base of 6α-[(R)-1-hydroxyethyl]-2-[(R)-tetrahydrofuran-2-yl]pen-2-em-3-carboxylic acid (CHEBI:51257) |
| Incoming Relation(s) |
| 6α-[(R)-1-hydroxyethyl]-2-[(R)-tetrahydrofuran-2-yl]pen-2-em-3-carboxylic acid (CHEBI:51257) is conjugate acid of 6α-[(R)-1-hydroxyethyl]-2-[(R)-tetrahydrofuran-2-yl]pen-2-em-3-carboxylate (CHEBI:51795) |
| IUPAC Name |
|---|
| 6α-[(1R)-1-hydroxyethyl]-2-[(2R)-tetrahydrofuran-2-yl]-2,3-didehydropenam-3-carboxylate |
| Synonym | Source |
|---|---|
| (5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-3-[(2R)-tetrahydrofuran-2-yl]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4299226 | Beilstein |