EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15NO5S |
| Net Charge | 0 |
| Average Mass | 285.321 |
| Monoisotopic Mass | 285.06709 |
| SMILES | [H][C@]1(C2=C(C(=O)O)N3C(=O)[C@]([H])([C@@H](C)O)[C@@]3([H])S2)CCCO1 |
| InChI | InChI=1S/C12H15NO5S/c1-5(14)7-10(15)13-8(12(16)17)9(19-11(7)13)6-3-2-4-18-6/h5-7,11,14H,2-4H2,1H3,(H,16,17)/t5-,6-,7+,11-/m1/s1 |
| InChIKey | HGGAKXAHAYOLDJ-FHZUQPTBSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6α-[(R)-1-hydroxyethyl]-2-[(R)-tetrahydrofuran-2-yl]pen-2-em-3-carboxylic acid (CHEBI:51257) is a faropenem (CHEBI:51788) |
| 6α-[(R)-1-hydroxyethyl]-2-[(R)-tetrahydrofuran-2-yl]pen-2-em-3-carboxylic acid (CHEBI:51257) is conjugate acid of 6α-[(R)-1-hydroxyethyl]-2-[(R)-tetrahydrofuran-2-yl]pen-2-em-3-carboxylate (CHEBI:51795) |
| Incoming Relation(s) |
| 6α-[(R)-1-hydroxyethyl]-2-[(R)-tetrahydrofuran-2-yl]pen-2-em-3-carboxylate (CHEBI:51795) is conjugate base of 6α-[(R)-1-hydroxyethyl]-2-[(R)-tetrahydrofuran-2-yl]pen-2-em-3-carboxylic acid (CHEBI:51257) |
| IUPAC Name |
|---|
| 6α-[(1R)-1-hydroxyethyl]-2-[(2R)-tetrahydrofuran-2-yl]-2,3-didehydropenam-3-carboxylic acid |
| INN | Source |
|---|---|
| fropenem | ChemIDplus |
| Synonyms | Source |
|---|---|
| (5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-3-[(2R)-tetrahydrofuran-2-yl]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid | IUPAC |
| (+)-(5R,6S)-6-((1R)-1-hydroxyethyl)-7-oxo-3-((2R)-tetrahydro-2-furyl)-4-thia-1-azabicyclo(3.2.0)hept-2-ene-2-carboxylic acid | ChemIDplus |
| faropenem | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1131 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7305146 | Beilstein |
| CAS:106560-14-9 | ChemIDplus |