EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16N5O4S |
| Net Charge | -1 |
| Average Mass | 374.402 |
| Monoisotopic Mass | 374.09285 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)[O-])N1C(=O)[C@H]2NC(=O)[C@H](N=[N+]=[N-])c1ccccc1 |
| InChI | InChI=1S/C16H17N5O4S/c1-16(2)11(15(24)25)21-13(23)10(14(21)26-16)18-12(22)9(19-20-17)8-6-4-3-5-7-8/h3-7,9-11,14H,1-2H3,(H,18,22)(H,24,25)/p-1/t9-,10-,11+,14-/m1/s1 |
| InChIKey | ODFHGIPNGIAMDK-NJBDSQKTSA-M |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azidocillin(1−) (CHEBI:51762) is a penicillinate anion (CHEBI:51356) |
| azidocillin(1−) (CHEBI:51762) is conjugate base of azidocillin (CHEBI:51758) |
| Incoming Relation(s) |
| azidocillin sodium (CHEBI:51761) has part azidocillin(1−) (CHEBI:51762) |
| azidocillin (CHEBI:51758) is conjugate acid of azidocillin(1−) (CHEBI:51762) |
| IUPAC Name |
|---|
| 2,2-dimethyl-6β-[(2R)-2-azido-2-phenylacetamido]penam-3α-carboxylate |
| Synonym | Source |
|---|---|
| (2S,5R,6R)-6-{[(2R)-2-azido-2-phenylacetyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate | IUPAC |