EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17N5O4S |
| Net Charge | 0 |
| Average Mass | 375.410 |
| Monoisotopic Mass | 375.10013 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)O)N1C(=O)[C@H]2NC(=O)[C@H](N=[N+]=[N-])c1ccccc1 |
| InChI | InChI=1S/C16H17N5O4S/c1-16(2)11(15(24)25)21-13(23)10(14(21)26-16)18-12(22)9(19-20-17)8-6-4-3-5-7-8/h3-7,9-11,14H,1-2H3,(H,18,22)(H,24,25)/t9-,10-,11+,14-/m1/s1 |
| InChIKey | ODFHGIPNGIAMDK-NJBDSQKTSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azidocillin (CHEBI:51758) is a penicillin (CHEBI:17334) |
| azidocillin (CHEBI:51758) is conjugate acid of azidocillin(1−) (CHEBI:51762) |
| Incoming Relation(s) |
| azidocillin(1−) (CHEBI:51762) is conjugate base of azidocillin (CHEBI:51758) |
| azidocilloyl group (CHEBI:58977) is substituent group from azidocillin (CHEBI:51758) |
| IUPAC Name |
|---|
| 2,2-dimethyl-6β-[(2R)-2-azido-2-phenylacetamido]penam-3α-carboxylic acid |
| INNs | Source |
|---|---|
| azidocilina | ChemIDplus |
| azidocilline | ChemIDplus |
| Synonyms | Source |
|---|---|
| (2S,5R,6R)-6-{[(2R)-2-azido-2-phenylacetyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | IUPAC |
| azidocillin | ChemIDplus |
| azidocillinum | ChemIDplus |
| D-(−)-(α-azidobenzyl)penicillin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:17243-38-8 | ChemIDplus |