EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:5132 - flutamide
| Formula | C11H11F3N2O3 |
| Net Charge | 0 |
| Average Mass | 276.214 |
| Monoisotopic Mass | 276.07218 |
| SMILES | CC(C)C(=O)Nc1ccc([N+](=O)[O-])c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H11F3N2O3/c1-6(2)10(17)15-7-3-4-9(16(18)19)8(5-7)11(12,13)14/h3-6H,1-2H3,(H,15,17) |
| InChIKey | MKXKFYHWDHIYRV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flutamide (CHEBI:5132) has role androgen antagonist (CHEBI:35497) |
| flutamide (CHEBI:5132) has role antineoplastic agent (CHEBI:35610) |
| flutamide (CHEBI:5132) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| flutamide (CHEBI:5132) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| 2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide |
| INNs | Source |
|---|---|
| flutamide | ChEBI |
| flutamida | ChEBI |
| flutamidum | ChEBI |
| Synonyms | Source |
|---|---|
| Flutamide | KEGG COMPOUND |
| 4'-nitro-3'-trifluoromethylisobutyranilide | ChemIDplus |
| α,α,α-trifluoro-2-methyl-4'-nitro-m-propionotoluidide | ChemIDplus |
| niftolid | ChEBI |
| Eulexin | ChemIDplus |
| Niftolide | ChemIDplus |