EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H31N3O2S.2C4H4O4 |
| Net Charge | 0 |
| Average Mass | 657.742 |
| Monoisotopic Mass | 657.23562 |
| SMILES | CCC(=O)c1ccc2c(c1)N(CCCN1CCN(CCO)CC1)c1ccccc1S2.O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C24H31N3O2S.2C4H4O4/c1-2-22(29)19-8-9-24-21(18-19)27(20-6-3-4-7-23(20)30-24)11-5-10-25-12-14-26(15-13-25)16-17-28;2*5-3(6)1-2-4(7)8/h3-4,6-9,18,28H,2,5,10-17H2,1H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1- |
| InChIKey | TVPJGGZLZLUPOB-SPIKMXEPSA-N |
| Roles Classification |
|---|
| Biological Role: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| Applications: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carphenazine maleate (CHEBI:51241) has part carfenazine (CHEBI:51235) |
| carphenazine maleate (CHEBI:51241) has role antiemetic (CHEBI:50919) |
| carphenazine maleate (CHEBI:51241) has role dopaminergic antagonist (CHEBI:48561) |
| carphenazine maleate (CHEBI:51241) has role phenothiazine antipsychotic drug (CHEBI:37930) |
| carphenazine maleate (CHEBI:51241) is a maleate salt (CHEBI:50221) |
| IUPAC Name |
|---|
| 1-(10-{3-[4-(2-hydroxyethyl)piperazin-1-yl]propyl}-10H-phenothiazin-2-yl)propan-1-one di[(2Z)-but-2-enedioate] |
| Synonyms | Source |
|---|---|
| 1-(10-(3-(4-(2-Hydroxyethyl)-1-piperazinyl)propyl)phenothiazin-2-yl)-1-propanone maleate(1:2) | ChemIDplus |
| 1-(10-{3-[4-(2-hydroxyethyl)piperazin-1-yl]propyl}-10H-phenothiazin-2-yl)propan-1-one (2Z)-but-2-enedioate (1:2) | ChEBI |
| 1-Propanone, 1-(10-(3-(4-(2-hydroxyethyl)-1-piperazinyl)propyl)-10H-phenothiazin-2-yl)-, (Z)-2-butenedioate (1:2) | ChemIDplus |
| Carfenazine maleate | ChemIDplus |
| Carphenazine dimaleate | ChemIDplus |
| proketazine dimaleate | ChemIDplus |
| Brand Name | Source |
|---|---|
| Proketazine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4938524 | ChemSpider |
| D02644 | KEGG DRUG |
| DBSALT001419 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15397689 | Reaxys |
| Beilstein:5709373 | Beilstein |
| CAS:2975-34-0 | ChemIDplus |
| Citations |
|---|