EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H31N3O2S |
| Net Charge | 0 |
| Average Mass | 425.598 |
| Monoisotopic Mass | 425.21370 |
| SMILES | CCC(=O)c1ccc2c(c1)N(CCCN1CCN(CCO)CC1)c1ccccc1S2 |
| InChI | InChI=1S/C24H31N3O2S/c1-2-22(29)19-8-9-24-21(18-19)27(20-6-3-4-7-23(20)30-24)11-5-10-25-12-14-26(15-13-25)16-17-28/h3-4,6-9,18,28H,2,5,10-17H2,1H3 |
| InChIKey | XZSMZRXAEFNJCU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| Applications: | antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carfenazine (CHEBI:51235) has role antiemetic (CHEBI:50919) |
| carfenazine (CHEBI:51235) has role dopaminergic antagonist (CHEBI:48561) |
| carfenazine (CHEBI:51235) has role phenothiazine antipsychotic drug (CHEBI:37930) |
| carfenazine (CHEBI:51235) is a N-(2-hydroxyethyl)piperazine (CHEBI:46851) |
| carfenazine (CHEBI:51235) is a N-alkylpiperazine (CHEBI:46845) |
| carfenazine (CHEBI:51235) is a aromatic ketone (CHEBI:76224) |
| carfenazine (CHEBI:51235) is a phenothiazines (CHEBI:38093) |
| Incoming Relation(s) |
| carphenazine maleate (CHEBI:51241) has part carfenazine (CHEBI:51235) |
| IUPAC Name |
|---|
| 1-(10-{3-[4-(2-hydroxyethyl)piperazin-1-yl]propyl}-10H-phenothiazin-2-yl)propan-1-one |
| INNs | Source |
|---|---|
| carfenazine | WHO MedNet |
| carfénazine | WHO MedNet |
| carfenazina | WHO MedNet |
| carfenazinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-(10-(3-(4-(2-hydroxyethyl)-1-piperazinyl)propyl)phenothiazin-2-yl)-1-propanone | ChemIDplus |
| carphenazine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| DB01038 | DrugBank |
| US2985654 | Patent |
| US3023146 | Patent |
| Carphenazine | Wikipedia |
| 516 | DrugCentral |
| HMDB0015172 | HMDB |
| 21865853 | ChemSpider |
| Citations |
|---|