EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H44F3N3O2S |
| Net Charge | 0 |
| Average Mass | 591.784 |
| Monoisotopic Mass | 591.31063 |
| SMILES | CCCCCCCCCC(=O)OCCN1CCN(CCCN2c3ccccc3Sc3ccc(C(F)(F)F)cc32)CC1 |
| InChI | InChI=1S/C32H44F3N3O2S/c1-2-3-4-5-6-7-8-14-31(39)40-24-23-37-21-19-36(20-22-37)17-11-18-38-27-12-9-10-13-29(27)41-30-16-15-26(25-28(30)38)32(33,34)35/h9-10,12-13,15-16,25H,2-8,11,14,17-24H2,1H3 |
| InChIKey | VIQCGTZFEYDQMR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluphenazine decanoate (CHEBI:5124) has functional parent fluphenazine (CHEBI:5123) |
| fluphenazine decanoate (CHEBI:5124) has role dopaminergic antagonist (CHEBI:48561) |
| fluphenazine decanoate (CHEBI:5124) has role phenothiazine antipsychotic drug (CHEBI:37930) |
| fluphenazine decanoate (CHEBI:5124) has role prodrug (CHEBI:50266) |
| fluphenazine decanoate (CHEBI:5124) is a N-alkylpiperazine (CHEBI:46845) |
| fluphenazine decanoate (CHEBI:5124) is a decanoate ester (CHEBI:87658) |
| fluphenazine decanoate (CHEBI:5124) is a organofluorine compound (CHEBI:37143) |
| fluphenazine decanoate (CHEBI:5124) is a phenothiazines (CHEBI:38093) |
| IUPAC Name |
|---|
| 2-(4-{3-[2-(trifluoromethyl)-10H-phenothiazin-10-yl]propyl}piperazin-1-yl)ethyl decanoate |
| Synonyms | Source |
|---|---|
| flufenazine decanoate | ChemIDplus |
| fluorophenazine decanoate | DrugCentral |
| fluphenaline decanoate | ChemIDplus |
| fluphenazine decanoate | ChemIDplus |
| fluphenazine depot | ChemIDplus |
| fluphenazine O-decanoate | ChemIDplus |
| Brand Names | Source |
|---|---|
| Anatensol decanoate | ChEBI |
| Dapotum D | ChemIDplus |
| Dapotum depot | ChEBI |
| Lyogen | ChemIDplus |
| Mirenil | ChEBI |
| Modecate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1213 | DrugCentral |
| C07956 | KEGG COMPOUND |
| D00793 | KEGG DRUG |
| DBSALT000776 | DrugBank |
| HMDB0252400 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Beilstein:0599852 | Beilstein |
| CAS:5002-47-1 | ChemIDplus |
| CAS:5002-47-1 | KEGG COMPOUND |
| Citations |
|---|