EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:5123 - fluphenazine
| Formula | C22H26F3N3OS |
| Net Charge | 0 |
| Average Mass | 437.531 |
| Monoisotopic Mass | 437.17487 |
| SMILES | OCCN1CCN(CCCN2c3ccccc3Sc3ccc(C(F)(F)F)cc32)CC1 |
| InChI | InChI=1S/C22H26F3N3OS/c23-22(24,25)17-6-7-21-19(16-17)28(18-4-1-2-5-20(18)30-21)9-3-8-26-10-12-27(13-11-26)14-15-29/h1-2,4-7,16,29H,3,8-15H2 |
| InChIKey | PLDUPXSUYLZYBN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| Applications: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluphenazine (CHEBI:5123) has parent hydride 10H-phenothiazine (CHEBI:37931) |
| fluphenazine (CHEBI:5123) has role anticoronaviral agent (CHEBI:149553) |
| fluphenazine (CHEBI:5123) has role antipsychotic agent (CHEBI:35476) |
| fluphenazine (CHEBI:5123) has role dopaminergic antagonist (CHEBI:48561) |
| fluphenazine (CHEBI:5123) has role phenothiazine antipsychotic drug (CHEBI:37930) |
| fluphenazine (CHEBI:5123) is a N-alkylpiperazine (CHEBI:46845) |
| fluphenazine (CHEBI:5123) is a organofluorine compound (CHEBI:37143) |
| fluphenazine (CHEBI:5123) is a phenothiazines (CHEBI:38093) |
| Incoming Relation(s) |
| fluphenazine decanoate (CHEBI:5124) has functional parent fluphenazine (CHEBI:5123) |
| IUPAC Name |
|---|
| 2-(4-{3-[2-(trifluoromethyl)-10H-phenothiazin-10-yl]propyl}piperazin-1-yl)ethan-1-ol |
| INNs | Source |
|---|---|
| fluphenazine | KEGG DRUG |
| fluphenazinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 10-(3-(2-hydroxyethyl)piperazinopropyl)-2-(trifluoromethyl)phenothiazine | NIST Chemistry WebBook |
| 10-(3'-(4''-(β-hydroxyethyl)-1''-piperazinyl)-propyl)-3-trifluoromethylphenothiazine | ChemIDplus |
| 1-(2-hydroxyethyl)-4-(3-(trifluoromethyl-10-phenothiazinyl)propyl)-piperazine | ChemIDplus |
| 2-(4-(3-[2-(trifluoromethyl)-10H-phenothiazin-10-yl]propyl)-1-piperazinyl)ethanol | NIST Chemistry WebBook |
| 2-(trifluoromethyl)-10-(3-(1-(β-hydroxyethyl)-4-piperazinyl)propyl)phenothiazine | ChemIDplus |
| 4-(3-(2-(trifluoromethyl)-10H-phenothiazin-10-yl)propyl)-1-piperazineethanol | ChemIDplus |
| Citations |
|---|