EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:5123 - fluphenazine
| Formula | C22H26F3N3OS |
| Net Charge | 0 |
| Average Mass | 437.531 |
| Monoisotopic Mass | 437.17487 |
| SMILES | OCCN1CCN(CCCN2c3ccccc3Sc3ccc(C(F)(F)F)cc32)CC1 |
| InChI | InChI=1S/C22H26F3N3OS/c23-22(24,25)17-6-7-21-19(16-17)28(18-4-1-2-5-20(18)30-21)9-3-8-26-10-12-27(13-11-26)14-15-29/h1-2,4-7,16,29H,3,8-15H2 |
| InChIKey | PLDUPXSUYLZYBN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| Applications: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluphenazine (CHEBI:5123) has parent hydride 10H-phenothiazine (CHEBI:37931) |
| fluphenazine (CHEBI:5123) has role anticoronaviral agent (CHEBI:149553) |
| fluphenazine (CHEBI:5123) has role dopaminergic antagonist (CHEBI:48561) |
| fluphenazine (CHEBI:5123) has role phenothiazine antipsychotic drug (CHEBI:37930) |
| fluphenazine (CHEBI:5123) is a N-alkylpiperazine (CHEBI:46845) |
| fluphenazine (CHEBI:5123) is a organofluorine compound (CHEBI:37143) |
| fluphenazine (CHEBI:5123) is a phenothiazines (CHEBI:38093) |
| Incoming Relation(s) |
| fluphenazine decanoate (CHEBI:5124) has functional parent fluphenazine (CHEBI:5123) |
| IUPAC Name |
|---|
| 2-(4-{3-[2-(trifluoromethyl)-10H-phenothiazin-10-yl]propyl}piperazin-1-yl)ethan-1-ol |
| INNs | Source |
|---|---|
| fluphenazine | KEGG DRUG |
| fluphenazinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 10-(3-(2-hydroxyethyl)piperazinopropyl)-2-(trifluoromethyl)phenothiazine | NIST Chemistry WebBook |
| 10-(3'-(4''-(β-hydroxyethyl)-1''-piperazinyl)-propyl)-3-trifluoromethylphenothiazine | ChemIDplus |
| 1-(2-hydroxyethyl)-4-(3-(trifluoromethyl-10-phenothiazinyl)propyl)-piperazine | ChemIDplus |
| 2-(4-(3-[2-(trifluoromethyl)-10H-phenothiazin-10-yl]propyl)-1-piperazinyl)ethanol | NIST Chemistry WebBook |
| 2-(trifluoromethyl)-10-(3-(1-(β-hydroxyethyl)-4-piperazinyl)propyl)phenothiazine | ChemIDplus |
| 4-(3-(2-(trifluoromethyl)-10H-phenothiazin-10-yl)propyl)-1-piperazineethanol | ChemIDplus |
| Citations |
|---|