EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:51210 - pivmecillinam
| Formula | C21H33N3O5S |
| Net Charge | 0 |
| Average Mass | 439.578 |
| Monoisotopic Mass | 439.21409 |
| SMILES | [H]C(=N[C@@H]1C(=O)N2[C@@H](C(=O)OCOC(=O)C(C)(C)C)C(C)(C)S[C@]12[H])N1CCCCCC1 |
| InChI | InChI=1S/C21H33N3O5S/c1-20(2,3)19(27)29-13-28-18(26)15-21(4,5)30-17-14(16(25)24(15)17)22-12-23-10-8-6-7-9-11-23/h12,14-15,17H,6-11,13H2,1-5H3/t14-,15+,17-/m1/s1 |
| InChIKey | NPGNOVNWUSPMDP-HLLBOEOZSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antibacterial drug A drug used to treat or prevent bacterial infections. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pivmecillinam (CHEBI:51210) has functional parent mecillinam (CHEBI:51208) |
| pivmecillinam (CHEBI:51210) has role antibacterial drug (CHEBI:36047) |
| pivmecillinam (CHEBI:51210) has role antiinfective agent (CHEBI:35441) |
| pivmecillinam (CHEBI:51210) has role prodrug (CHEBI:50266) |
| pivmecillinam (CHEBI:51210) is a penicillanic acid ester (CHEBI:51212) |
| pivmecillinam (CHEBI:51210) is a penicillin (CHEBI:17334) |
| pivmecillinam (CHEBI:51210) is a pivaloyloxymethyl ester (CHEBI:136685) |
| Incoming Relation(s) |
| pivmecillinam hydrochloride (CHEBI:51213) has part pivmecillinam (CHEBI:51210) |
| IUPAC Name |
|---|
| [(2,2-dimethylpropanoyl)oxy]methyl 6β-[(azepan-1-ylmethylidene)amino]-2,2-dimethylpenam-3α-carboxylate |
| INNs | Source |
|---|---|
| pivmecilinamo | ChemIDplus |
| pivmecillinamum | ChemIDplus |
| pivmecillinam | ChemIDplus |
| Synonyms | Source |
|---|---|
| [(2,2-dimethylpropanoyl)oxy]methyl (2S,5R,6R)-6-[(azepan-1-ylmethylidene)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate | IUPAC |
| amdinocillin, pivaloyloxymethyl ester | ChEBI |
| amdinocillin pivoxil | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:9014155 | Beilstein |
| CAS:32886-97-8 | ChemIDplus |