EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23N3O3S |
| Net Charge | 0 |
| Average Mass | 325.434 |
| Monoisotopic Mass | 325.14601 |
| SMILES | [H]C(=N[C@@H]1C(=O)N2[C@@H](C(=O)O)C(C)(C)S[C@]12[H])N1CCCCCC1 |
| InChI | InChI=1S/C15H23N3O3S/c1-15(2)11(14(20)21)18-12(19)10(13(18)22-15)16-9-17-7-5-3-4-6-8-17/h9-11,13H,3-8H2,1-2H3,(H,20,21)/t10-,11+,13-/m1/s1 |
| InChIKey | BWWVAEOLVKTZFQ-NTZNESFSSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mecillinam (CHEBI:51208) has role antibacterial drug (CHEBI:36047) |
| mecillinam (CHEBI:51208) has role antiinfective agent (CHEBI:35441) |
| mecillinam (CHEBI:51208) is a penicillin (CHEBI:17334) |
| Incoming Relation(s) |
| pivmecillinam (CHEBI:51210) has functional parent mecillinam (CHEBI:51208) |
| IUPAC Name |
|---|
| 6β-{[(azepan-1-yl)methylidene]amino}-2,2-dimethylpenam-3α-carboxylic acid |
| INNs | Source |
|---|---|
| mecilinamo | ChemIDplus |
| mecillinamum | ChemIDplus |
| mecillinam | ChemIDplus |
| Synonyms | Source |
|---|---|
| (2S,5R,6R)-6-[(azepan-1-ylmethylidene)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | IUPAC |
| penicillin HX | ChemIDplus |
| amdinocillin | ChemIDplus |
| Brand Name | Source |
|---|---|
| Coactin | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1223657 | Reaxys |
| CAS:32887-01-7 | ChemIDplus |