EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C9H13N.H2O4S |
| Net Charge | 0 |
| Average Mass | 368.499 |
| Monoisotopic Mass | 368.17698 |
| SMILES | CC(N)Cc1ccccc1.CC(N)Cc1ccccc1.O=S(=O)(O)O |
| InChI | InChI=1S/2C9H13N.H2O4S/c2*1-8(10)7-9-5-3-2-4-6-9;1-5(2,3)4/h2*2-6,8H,7,10H2,1H3;(H2,1,2,3,4) |
| InChIKey | PYHRZPFZZDCOPH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-obesity agent Any substance which is used to reduce or control weight. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amphetamine sulfate (CHEBI:51063) has part amphetamine (CHEBI:2679) |
| amphetamine sulfate (CHEBI:51063) has role anti-obesity agent (CHEBI:74518) |
| amphetamine sulfate (CHEBI:51063) is a organic sulfate salt (CHEBI:51337) |
| Incoming Relation(s) |
| (S)-amphetamine sulfate (CHEBI:51064) is a amphetamine sulfate (CHEBI:51063) |
| IUPAC Name |
|---|
| bis{1-phenylpropan-2-amine} sulfate |
| Synonyms | Source |
|---|---|
| (+-)-2-Amino-1-phenylpropane sulfate | ChemIDplus |
| (+-)-alpha-Methylphenethylamine sulfate (2:1) | ChemIDplus |
| Amfetamine sulfate | ChEMBL |
| Amfetamine sulphate | ChEMBL |
| Amphamine sulfate | ChemIDplus |
| (+-)-Amphetamine sulfate | ChemIDplus |
| Brand Names | Source |
|---|---|
| Amphetamine sulfate component of delcobese | ChEMBL |
| Amphetamine sulfate component of mydayis | ChEMBL |
| Evekeo | ChEMBL |
| Evekeo odt | ChEMBL |
| Citations |
|---|