EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:51045 - cyclizine hydrochloride
| Formula | C18H22N2.HCl |
| Net Charge | 0 |
| Average Mass | 302.849 |
| Monoisotopic Mass | 302.15498 |
| SMILES | CN1CCN(C(c2ccccc2)c2ccccc2)CC1.Cl |
| InChI | InChI=1S/C18H22N2.ClH/c1-19-12-14-20(15-13-19)18(16-8-4-2-5-9-16)17-10-6-3-7-11-17;/h2-11,18H,12-15H2,1H3;1H |
| InChIKey | UKPBEPCQTDRZSE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. central nervous system depressant A loosely defined group of drugs that tend to reduce the activity of the central nervous system. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclizine hydrochloride (CHEBI:51045) has part cyclizine (CHEBI:3994) |
| cyclizine hydrochloride (CHEBI:51045) has role antiemetic (CHEBI:50919) |
| cyclizine hydrochloride (CHEBI:51045) has role central nervous system depressant (CHEBI:35488) |
| cyclizine hydrochloride (CHEBI:51045) has role cholinergic antagonist (CHEBI:48873) |
| cyclizine hydrochloride (CHEBI:51045) has role H1-receptor antagonist (CHEBI:37955) |
| cyclizine hydrochloride (CHEBI:51045) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 1-(diphenylmethyl)-4-methylpiperazine hydrochloride |
| Synonyms | Source |
|---|---|
| 1-(Diphenylmethyl)-4-methylpiperazine monohydrochloride | ChemIDplus |
| Cyclizine HCl | ChemIDplus |
| (±)-1-diphenylmethyl-4-methylpiperazine hydrochloride | ChemIDplus |
| cyclizine monohydrochloride | ChemIDplus |
| Brand Name | Source |
|---|---|
| Valoid | ChEBI |