EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22N2.HCl |
| Net Charge | 0 |
| Average Mass | 302.849 |
| Monoisotopic Mass | 302.15498 |
| SMILES | CN1CCN(C(c2ccccc2)c2ccccc2)CC1.Cl |
| InChI | InChI=1S/C18H22N2.ClH/c1-19-12-14-20(15-13-19)18(16-8-4-2-5-9-16)17-10-6-3-7-11-17;/h2-11,18H,12-15H2,1H3;1H |
| InChIKey | UKPBEPCQTDRZSE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. |
| Applications: | antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. central nervous system depressant A loosely defined group of drugs that tend to reduce the activity of the central nervous system. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclizine hydrochloride (CHEBI:51045) has part cyclizine (CHEBI:3994) |
| cyclizine hydrochloride (CHEBI:51045) has role antiemetic (CHEBI:50919) |
| cyclizine hydrochloride (CHEBI:51045) has role central nervous system depressant (CHEBI:35488) |
| cyclizine hydrochloride (CHEBI:51045) has role cholinergic antagonist (CHEBI:48873) |
| cyclizine hydrochloride (CHEBI:51045) has role H1-receptor antagonist (CHEBI:37955) |
| cyclizine hydrochloride (CHEBI:51045) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 1-(diphenylmethyl)-4-methylpiperazine hydrochloride |
| Synonyms | Source |
|---|---|
| (±)-1-diphenylmethyl-4-methylpiperazine hydrochloride | ChemIDplus |
| 1-(Diphenylmethyl)-4-methylpiperazine monohydrochloride | ChemIDplus |
| Cyclizine HCl | ChemIDplus |
| cyclizine monohydrochloride | ChemIDplus |
| Brand Name | Source |
|---|---|
| Valoid | ChEBI |