EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3994 - cyclizine
| Formula | C18H22N2 |
| Net Charge | 0 |
| Average Mass | 266.388 |
| Monoisotopic Mass | 266.17830 |
| SMILES | CN1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H22N2/c1-19-12-14-20(15-13-19)18(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11,18H,12-15H2,1H3 |
| InChIKey | UVKZSORBKUEBAZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. central nervous system depressant A loosely defined group of drugs that tend to reduce the activity of the central nervous system. local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclizine (CHEBI:3994) has role antiemetic (CHEBI:50919) |
| cyclizine (CHEBI:3994) has role central nervous system depressant (CHEBI:35488) |
| cyclizine (CHEBI:3994) has role cholinergic antagonist (CHEBI:48873) |
| cyclizine (CHEBI:3994) has role H1-receptor antagonist (CHEBI:37955) |
| cyclizine (CHEBI:3994) has role local anaesthetic (CHEBI:36333) |
| cyclizine (CHEBI:3994) is a N-alkylpiperazine (CHEBI:46845) |
| Incoming Relation(s) |
| cyclizine hydrochloride (CHEBI:51045) has part cyclizine (CHEBI:3994) |
| IUPAC Name |
|---|
| 1-(diphenylmethyl)-4-methylpiperazine |
| INNs | Source |
|---|---|
| ciclizina | ChEBI |
| cyclizine | ChEBI |
| cyclizine | ChemIDplus |
| cyclizinum | ChEBI |
| Synonyms | Source |
|---|---|
| 1-Benzhydryl-4-methylpiperazin | ChemIDplus |
| (±)-1-diphenylmethyl-4-methylpiperazine | ChEBI |
| 1-(Diphenylmethyl)-4-methylpiperazine | ChemIDplus |
| Cyclizine | KEGG COMPOUND |
| (N-Benzhydryl)(N'-methyl)diethylenediamine | ChemIDplus |
| N-Benzhydryl-N'-methylpiperazine | ChemIDplus |
| Citations |
|---|