EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14FN3O3 |
| Net Charge | 0 |
| Average Mass | 303.293 |
| Monoisotopic Mass | 303.10192 |
| SMILES | CCOC(=O)c1ncn2c1CN(C)C(=O)c1cc(F)ccc1-2 |
| InChI | InChI=1S/C15H14FN3O3/c1-3-22-15(21)13-12-7-18(2)14(20)10-6-9(16)4-5-11(10)19(12)8-17-13/h4-6,8H,3,7H2,1-2H3 |
| InChIKey | OFBIFZUFASYYRE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | GABA antagonist A compound that inhibits the action of γ-aminobutyric acid. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| Applications: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. antiparkinson drug A drug used in the treatment of Parkinson's disease. antidote to benzodiazepine poisoning A role borne by a molecule that acts to counteract or neutralise the deleterious effects of benzodiazepines. GABA antagonist A compound that inhibits the action of γ-aminobutyric acid. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flumazenil (CHEBI:5103) has role antidote to benzodiazepine poisoning (CHEBI:90757) |
| flumazenil (CHEBI:5103) has role antiparkinson drug (CHEBI:48407) |
| flumazenil (CHEBI:5103) has role anxiolytic drug (CHEBI:35474) |
| flumazenil (CHEBI:5103) has role GABA antagonist (CHEBI:65259) |
| flumazenil (CHEBI:5103) is a ethyl ester (CHEBI:23990) |
| flumazenil (CHEBI:5103) is a imidazobenzodiazepine (CHEBI:142118) |
| flumazenil (CHEBI:5103) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| ethyl 8-fluoro-5-methyl-6-oxo-5,6-dihydro-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate |
| INNs | Source |
|---|---|
| flumazenil | ChemIDplus |
| flumazenilo | ChemIDplus |
| flumazenilum | ChemIDplus |
| Synonyms | Source |
|---|---|
| NSC-759193 | ChEMBL |
| RO-151788 | ChEMBL |
| RO 15-1788/000 | ChEMBL |
| RO-15-1788/000 | ChEMBL |
| RO-151788000 | ChEMBL |
| RO-1722 | ChEMBL |
| Brand Names | Source |
|---|---|
| Anexate | DrugBank |
| Lanexat | DrugBank |
| Romazicon | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1195 | DrugCentral |
| C07825 | KEGG COMPOUND |
| D00697 | KEGG DRUG |
| DB01205 | DrugBank |
| Flumazenil | Wikipedia |
| HMDB0015336 | HMDB |
| LSM-4228 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4763661 | Reaxys |
| CAS:78755-81-4 | ChemIDplus |
| Citations |
|---|