EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H31FO6 |
| Net Charge | 0 |
| Average Mass | 422.493 |
| Monoisotopic Mass | 422.21047 |
| SMILES | [H][C@@]12CC[C@](O)(C(=O)COC(C)=O)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])CCC2=CC(=O)CC[C@@]21C |
| InChI | InChI=1S/C23H31FO6/c1-13(25)30-12-19(28)22(29)9-7-16-17-5-4-14-10-15(26)6-8-20(14,2)23(17,24)18(27)11-21(16,22)3/h10,16-18,27,29H,4-9,11-12H2,1-3H3/t16-,17-,18-,20-,21-,22-,23-/m0/s1 |
| InChIKey | SYWHXTATXSMDSB-GSLJADNHSA-N |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiparkinson drug A drug used in the treatment of Parkinson's disease. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fludrocortisone acetate (CHEBI:5102) has functional parent fludrocortisone (CHEBI:50885) |
| fludrocortisone acetate (CHEBI:5102) has role antidepressant (CHEBI:35469) |
| fludrocortisone acetate (CHEBI:5102) has role antineoplastic agent (CHEBI:35610) |
| fludrocortisone acetate (CHEBI:5102) has role antiparkinson drug (CHEBI:48407) |
| fludrocortisone acetate (CHEBI:5102) has role antiviral agent (CHEBI:22587) |
| fludrocortisone acetate (CHEBI:5102) is a 11β-hydroxy steroid (CHEBI:35346) |
| fludrocortisone acetate (CHEBI:5102) is a 17α-hydroxy steroid (CHEBI:35342) |
| fludrocortisone acetate (CHEBI:5102) is a 20-oxo steroid (CHEBI:36885) |
| fludrocortisone acetate (CHEBI:5102) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| fludrocortisone acetate (CHEBI:5102) is a acetate ester (CHEBI:47622) |
| fludrocortisone acetate (CHEBI:5102) is a fluorinated steroid (CHEBI:50830) |
| fludrocortisone acetate (CHEBI:5102) is a mineralocorticoid (CHEBI:25354) |
| fludrocortisone acetate (CHEBI:5102) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| 9-fluoro-11β,17-dihydroxy-3,20-dioxopregn-4-en-21-yl acetate |
| Synonyms | Source |
|---|---|
| (11β)-9-fluoro-11,17-dihydroxy-3,20-dioxopregn-4-en-21-yl acetate | IUPAC |
| 9α-fluorohydrocortisone 21-acetate | ChemIDplus |
| 9α-fluorohydrocortisone acetate | ChemIDplus |
| fludrocortisone 21-acetate | ChemIDplus |
| Fludrocortisoni acetas | ChEMBL |
| fluohydrocortisone acetate | ChemIDplus |
| Brand Names | Source |
|---|---|
| Alflorone | ChEBI |
| Alflorone acetate | ChemIDplus |
| Astonin | ChEMBL |
| Cortef-F | ChemIDplus |
| Cortineff | ChemIDplus |
| F-Cortef | ChEBI |
| Citations |
|---|