EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H29FO5 |
| Net Charge | 0 |
| Average Mass | 380.456 |
| Monoisotopic Mass | 380.19990 |
| SMILES | [H][C@@]12CC[C@](O)(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])CCC2=CC(=O)CC[C@@]21C |
| InChI | InChI=1S/C21H29FO5/c1-18-7-5-13(24)9-12(18)3-4-15-14-6-8-20(27,17(26)11-23)19(14,2)10-16(25)21(15,18)22/h9,14-16,23,25,27H,3-8,10-11H2,1-2H3/t14-,15-,16-,18-,19-,20-,21-/m0/s1 |
| InChIKey | AAXVEMMRQDVLJB-BULBTXNYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | adrenergic agent Any agent that acts on an adrenergic receptor or affects the life cycle of an adrenergic transmitter. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | adrenergic agent Any agent that acts on an adrenergic receptor or affects the life cycle of an adrenergic transmitter. anti-inflammatory drug A substance that reduces or suppresses inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fludrocortisone (CHEBI:50885) has parent hydride pregnane (CHEBI:8386) |
| fludrocortisone (CHEBI:50885) has role adrenergic agent (CHEBI:37962) |
| fludrocortisone (CHEBI:50885) has role anti-inflammatory drug (CHEBI:35472) |
| fludrocortisone (CHEBI:50885) is a 11β-hydroxy steroid (CHEBI:35346) |
| fludrocortisone (CHEBI:50885) is a 17α-hydroxy steroid (CHEBI:35342) |
| fludrocortisone (CHEBI:50885) is a 20-oxo steroid (CHEBI:36885) |
| fludrocortisone (CHEBI:50885) is a 21-hydroxy steroid (CHEBI:35344) |
| fludrocortisone (CHEBI:50885) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| fludrocortisone (CHEBI:50885) is a C21-steroid (CHEBI:61313) |
| fludrocortisone (CHEBI:50885) is a fluorinated steroid (CHEBI:50830) |
| fludrocortisone (CHEBI:50885) is a mineralocorticoid (CHEBI:25354) |
| Incoming Relation(s) |
| fludrocortisone acetate (CHEBI:5102) has functional parent fludrocortisone (CHEBI:50885) |
| IUPAC Name |
|---|
| 9-fluoro-11β,17,21-trihydroxypregn-4-ene-3,20-dione |
| INNs | Source |
|---|---|
| fludrocortisona | ChemIDplus |
| fludrocortisone | WHO MedNet |
| fludrocortisone | ChemIDplus |
| fludrocortisonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 9ALPHA-FLUOROCORTISOL | PDBeChem |
| Fludrocortisone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C07004 | KEGG COMPOUND |
| D07967 | KEGG DRUG |
| DB00687 | DrugBank |
| Fludrocortisone | Wikipedia |
| GB792224 | Patent |
| LMST02030103 | LIPID MAPS |
| US2852511 | Patent |
| ZK5 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3014278 | Beilstein |
| CAS:127-31-1 | ChemIDplus |
| CAS:127-31-1 | KEGG COMPOUND |