EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17N7 |
| Net Charge | 0 |
| Average Mass | 319.372 |
| Monoisotopic Mass | 319.15454 |
| SMILES | Nc1ncnc2c1c(-c1cnc3nccc3c1)nn2C1CCCC1 |
| InChI | InChI=1S/C17H17N7/c18-15-13-14(11-7-10-5-6-19-16(10)20-8-11)23-24(12-3-1-2-4-12)17(13)22-9-21-15/h5-9,12H,1-4H2,(H,19,20)(H2,18,21,22) |
| InChIKey | NVRXTLZYXZNATH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor An inhibitor of phosphatidylinositol 3-kinase, EC 2.7.1.137, a family of related enzymes capable of phosphorylating the 3 position hydroxy group of the inositol ring of a phosphatidylinositol. tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PP121 (CHEBI:50915) has role antineoplastic agent (CHEBI:35610) |
| PP121 (CHEBI:50915) has role EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor (CHEBI:50914) |
| PP121 (CHEBI:50915) has role tyrosine kinase inhibitor (CHEBI:38637) |
| PP121 (CHEBI:50915) is a aromatic amine (CHEBI:33860) |
| PP121 (CHEBI:50915) is a cyclopentanes (CHEBI:23493) |
| PP121 (CHEBI:50915) is a pyrazolopyrimidine (CHEBI:38669) |
| PP121 (CHEBI:50915) is a pyrrolopyridine (CHEBI:46771) |
| IUPAC Name |
|---|
| 1-cyclopentyl-3-(1H-pyrrolo[2,3-b]pyridin-5-yl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine |
| Synonym | Source |
|---|---|
| PP-121 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:1092788-83-4 | ChemIDplus |
| Citations |
|---|