EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27ClO5 |
| Net Charge | 0 |
| Average Mass | 394.895 |
| Monoisotopic Mass | 394.15470 |
| SMILES | [H][C@@]12CC[C@](O)(C(=O)OCCl)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C21H27ClO5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,18(25)27-11-22)20(15,2)10-16(24)17(14)19/h5,7,9,14-17,24,26H,3-4,6,8,10-11H2,1-2H3/t14-,15-,16-,17+,19-,20-,21-/m0/s1 |
| InChIKey | YPZVAYHNBBHPTO-MXRBDKCISA-N |
| Roles Classification |
|---|
| Application: | antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| loteprednol (CHEBI:50848) has role antilipemic drug (CHEBI:35679) |
| loteprednol (CHEBI:50848) is a 11β-hydroxy steroid (CHEBI:35346) |
| loteprednol (CHEBI:50848) is a 17α-hydroxy steroid (CHEBI:35342) |
| loteprednol (CHEBI:50848) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| loteprednol (CHEBI:50848) is a androstanoid (CHEBI:50402) |
| loteprednol (CHEBI:50848) is a organochlorine compound (CHEBI:36683) |
| loteprednol (CHEBI:50848) is a steroid acid ester (CHEBI:47887) |
| Incoming Relation(s) |
| loteprednol etabonate (CHEBI:31784) has functional parent loteprednol (CHEBI:50848) |
| IUPAC Name |
|---|
| chloromethyl 11β,17α-dihydroxy-3-oxoandrosta-1,4-diene-17β-carboxylate |
| INN | Source |
|---|---|
| loteprednol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| DB00873 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:129260-79-3 | ChemIDplus |