EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H31ClO7 |
| Net Charge | 0 |
| Average Mass | 466.958 |
| Monoisotopic Mass | 466.17583 |
| SMILES | [H][C@@]12CC[C@](OC(=O)OCC)(C(=O)OCCl)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C24H31ClO7/c1-4-30-21(29)32-24(20(28)31-13-25)10-8-17-16-6-5-14-11-15(26)7-9-22(14,2)19(16)18(27)12-23(17,24)3/h7,9,11,16-19,27H,4-6,8,10,12-13H2,1-3H3/t16-,17-,18-,19+,22-,23-,24-/m0/s1 |
| InChIKey | DMKSVUSAATWOCU-HROMYWEYSA-N |
| Roles Classification |
|---|
| Applications: | anti-inflammatory drug A substance that reduces or suppresses inflammation. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| loteprednol etabonate (CHEBI:31784) has functional parent loteprednol (CHEBI:50848) |
| loteprednol etabonate (CHEBI:31784) has role anti-inflammatory agent (CHEBI:67079) |
| loteprednol etabonate (CHEBI:31784) has role anti-inflammatory drug (CHEBI:35472) |
| loteprednol etabonate (CHEBI:31784) has role ophthalmology drug (CHEBI:66981) |
| loteprednol etabonate (CHEBI:31784) is a 11β-hydroxy steroid (CHEBI:35346) |
| loteprednol etabonate (CHEBI:31784) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| loteprednol etabonate (CHEBI:31784) is a etabonate ester (CHEBI:50850) |
| loteprednol etabonate (CHEBI:31784) is a organochlorine compound (CHEBI:36683) |
| loteprednol etabonate (CHEBI:31784) is a steroid acid ester (CHEBI:47887) |
| loteprednol etabonate (CHEBI:31784) is a steroid ester (CHEBI:47880) |
| IUPAC Name |
|---|
| chloromethyl 17α-[(ethoxycarbonyl)oxy]-11β-hydroxy-3-oxoandrosta-1,4-diene-17β-carboxylate |
| Synonyms | Source |
|---|---|
| CDDD 5604 | ChEMBL |
| CDDD-5604 | ChEMBL |
| CDDD5604 | ChEMBL |
| HGP-1 | ChEMBL |
| KPI-121 | ChEMBL |
| Loteprednol etabonate | ChEMBL |
| Brand Names | Source |
|---|---|
| Alrex | ChEMBL |
| Eysuvis | ChEMBL |
| Inveltys | ChEMBL |
| Lotemax sm | ChEMBL |
| Loteprednol etabonate component of zylet | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5461012 | Beilstein |
| CAS:82034-46-6 | ChemIDplus |
| CAS:82034-46-6 | KEGG DRUG |
| Citations |
|---|