EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H17NO3S |
| Net Charge | 0 |
| Average Mass | 207.295 |
| Monoisotopic Mass | 207.09291 |
| SMILES | CSCCCCCC(NO)C(=O)O |
| InChI | InChI=1S/C8H17NO3S/c1-13-6-4-2-3-5-7(9-12)8(10)11/h7,9,12H,2-6H2,1H3,(H,10,11) |
| InChIKey | JCEAPZJPOHTKKJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-hydroxytrihomomethionine (CHEBI:50761) has functional parent trihomomethionine (CHEBI:50711) |
| N-hydroxytrihomomethionine (CHEBI:50761) is a N-hydroxy-α-amino-acid (CHEBI:50760) |
| N-hydroxytrihomomethionine (CHEBI:50761) is conjugate acid of N-hydroxytrihomomethioninate (CHEBI:58841) |
| Incoming Relation(s) |
| N-hydroxy-L-trihomomethionine (CHEBI:137023) is a N-hydroxytrihomomethionine (CHEBI:50761) |
| N-hydroxytrihomomethioninate (CHEBI:58841) is conjugate base of N-hydroxytrihomomethionine (CHEBI:50761) |
| IUPAC Name |
|---|
| 2-(hydroxyamino)-7-(methylsulfanyl)heptanoic acid |