EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H17NO2S |
| Net Charge | 0 |
| Average Mass | 191.296 |
| Monoisotopic Mass | 191.09800 |
| SMILES | CSCCCCCC(N)C(=O)O |
| InChI | InChI=1S/C8H17NO2S/c1-12-6-4-2-3-5-7(9)8(10)11/h7H,2-6,9H2,1H3,(H,10,11) |
| InChIKey | UKDJCWUSWYBRDM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trihomomethionine (CHEBI:50711) is a methyl sulfide (CHEBI:86315) |
| trihomomethionine (CHEBI:50711) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| trihomomethionine (CHEBI:50711) is a sulfur-containing amino acid (CHEBI:26834) |
| trihomomethionine (CHEBI:50711) is tautomer of trihomomethionine zwitterion (CHEBI:58833) |
| Incoming Relation(s) |
| N-hydroxytrihomomethionine (CHEBI:50761) has functional parent trihomomethionine (CHEBI:50711) |
| N,N-dihydroxytrihomomethionine (CHEBI:50768) has functional parent trihomomethionine (CHEBI:50711) |
| L-trihomomethionine (CHEBI:136999) is a trihomomethionine (CHEBI:50711) |
| trihomomethionine zwitterion (CHEBI:58833) is tautomer of trihomomethionine (CHEBI:50711) |
| IUPAC Name |
|---|
| 2-amino-7-(methylsulfanyl)heptanoic acid |
| Synonym | Source |
|---|---|
| 2-Amino-7-(methylsulfanyl)heptanoic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C17221 | KEGG COMPOUND |