EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO2S |
| Net Charge | 0 |
| Average Mass | 163.242 |
| Monoisotopic Mass | 163.06670 |
| SMILES | CSCCC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C6H13NO2S/c1-10-4-2-3-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9)/t5-/m1/s1 |
| InChIKey | SFSJZXMDTNDWIX-RXMQYKEDSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-homomethionine (CHEBI:50709) is a homomethionine (CHEBI:50707) |
| D-homomethionine (CHEBI:50709) is enantiomer of L-homomethionine (CHEBI:50708) |
| Incoming Relation(s) |
| L-homomethionine (CHEBI:50708) is enantiomer of D-homomethionine (CHEBI:50709) |
| IUPAC Names |
|---|
| (2R)-2-amino-5-(methylsulfanyl)pentanoic acid |
| 5-(methylsulfanyl)-D-norvaline |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4658034 | Beilstein |