EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO2S |
| Net Charge | 0 |
| Average Mass | 163.242 |
| Monoisotopic Mass | 163.06670 |
| SMILES | CSCCCC(N)C(=O)O |
| InChI | InChI=1S/C6H13NO2S/c1-10-4-2-3-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9) |
| InChIKey | SFSJZXMDTNDWIX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| homomethionine (CHEBI:50707) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| homomethionine (CHEBI:50707) is a sulfur-containing amino acid (CHEBI:26834) |
| homomethionine (CHEBI:50707) is conjugate acid of homomethioninate (CHEBI:62936) |
| Incoming Relation(s) |
| D-homomethionine (CHEBI:50709) is a homomethionine (CHEBI:50707) |
| L-homomethionine (CHEBI:50708) is a homomethionine (CHEBI:50707) |
| homomethioninate (CHEBI:62936) is conjugate base of homomethionine (CHEBI:50707) |
| IUPAC Names |
|---|
| 2-amino-5-(methylsulfanyl)pentanoic acid |
| 5-(methylsulfanyl)norvaline |
| Manual Xrefs | Databases |
|---|---|
| C17213 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1760516 | Beilstein |