EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H9N3O |
| Net Charge | 0 |
| Average Mass | 211.224 |
| Monoisotopic Mass | 211.07456 |
| SMILES | Cc1nc(=O)c(C#N)cc1-c1ccncc1 |
| InChI | InChI=1S/C12H9N3O/c1-8-11(9-2-4-14-5-3-9)6-10(7-13)12(16)15-8/h2-6H,1H3,(H,15,16) |
| InChIKey | PZRHRDRVRGEVNW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 3.1.4.17 (3',5'-cyclic-nucleotide phosphodiesterase) inhibitor An EC 3.1.4.* (phosphoric diester hydrolase) inhibitor which interferes with the action of 3',5'-cyclic-nucleotide phosphodiesterase (EC 3.1.4.17). |
| Applications: | vasodilator agent A drug used to cause dilation of the blood vessels. cardiotonic drug A drug that has a strengthening effect on the heart or that can increase cardiac output. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| milrinone (CHEBI:50693) has role antihypertensive agent (CHEBI:35674) |
| milrinone (CHEBI:50693) has role antispasmodic drug (CHEBI:53784) |
| milrinone (CHEBI:50693) has role cardiotonic drug (CHEBI:38147) |
| milrinone (CHEBI:50693) has role cardiovascular drug (CHEBI:35554) |
| milrinone (CHEBI:50693) has role EC 3.1.4.17 (3',5'-cyclic-nucleotide phosphodiesterase) inhibitor (CHEBI:50568) |
| milrinone (CHEBI:50693) has role platelet aggregation inhibitor (CHEBI:50427) |
| milrinone (CHEBI:50693) has role vasodilator agent (CHEBI:35620) |
| milrinone (CHEBI:50693) is a bipyridines (CHEBI:50511) |
| milrinone (CHEBI:50693) is a nitrile (CHEBI:18379) |
| milrinone (CHEBI:50693) is a pyridone (CHEBI:38183) |
| Incoming Relation(s) |
| milrinone lactate (CHEBI:34850) has part milrinone (CHEBI:50693) |
| IUPAC Name |
|---|
| 2-methyl-6-oxo-1,6-dihydro-3,4'-bipyridine-5-carbonitrile |
| INNs | Source |
|---|---|
| milrinona | ChemIDplus |
| milrinone | WHO MedNet |
| milrinone | ChemIDplus |
| milrinonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1,6-Dihydro-2-methyl-6-oxo(3,4'-bipyridine)-5-carbonitrile | ChemIDplus |
| Milrila | ChEMBL |
| Milrinone | KEGG COMPOUND |
| NSC-760072 | ChEMBL |
| WIN 47,203-2 | ChEMBL |
| WIN-47203-2 | ChEMBL |
| Citations |
|---|