EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H9N3O |
| Net Charge | 0 |
| Average Mass | 211.224 |
| Monoisotopic Mass | 211.07456 |
| SMILES | Cc1nc(=O)c(C#N)cc1-c1ccncc1 |
| InChI | InChI=1S/C12H9N3O/c1-8-11(9-2-4-14-5-3-9)6-10(7-13)12(16)15-8/h2-6H,1H3,(H,15,16) |
| InChIKey | PZRHRDRVRGEVNW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 3.1.4.17 (3',5'-cyclic-nucleotide phosphodiesterase) inhibitor An EC 3.1.4.* (phosphoric diester hydrolase) inhibitor which interferes with the action of 3',5'-cyclic-nucleotide phosphodiesterase (EC 3.1.4.17). |
| Applications: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. vasodilator agent A drug used to cause dilation of the blood vessels. cardiotonic drug A drug that has a strengthening effect on the heart or that can increase cardiac output. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| milrinone (CHEBI:50693) has role cardiotonic drug (CHEBI:38147) |
| milrinone (CHEBI:50693) has role EC 3.1.4.17 (3',5'-cyclic-nucleotide phosphodiesterase) inhibitor (CHEBI:50568) |
| milrinone (CHEBI:50693) has role platelet aggregation inhibitor (CHEBI:50427) |
| milrinone (CHEBI:50693) has role vasodilator agent (CHEBI:35620) |
| milrinone (CHEBI:50693) is a bipyridines (CHEBI:50511) |
| milrinone (CHEBI:50693) is a nitrile (CHEBI:18379) |
| milrinone (CHEBI:50693) is a pyridone (CHEBI:38183) |
| Incoming Relation(s) |
| milrinone lactate (CHEBI:34850) has part milrinone (CHEBI:50693) |
| IUPAC Name |
|---|
| 2-methyl-6-oxo-1,6-dihydro-3,4'-bipyridine-5-carbonitrile |
| INNs | Source |
|---|---|
| milrinona | ChemIDplus |
| milrinone | WHO MedNet |
| milrinone | ChemIDplus |
| milrinonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1,6-Dihydro-2-methyl-6-oxo(3,4'-bipyridine)-5-carbonitrile | ChemIDplus |
| Milrinone | KEGG COMPOUND |
| Citations |
|---|