EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C12H9N3O.C3H5O3 |
| Net Charge | 0 |
| Average Mass | 301.302 |
| Monoisotopic Mass | 301.10626 |
| SMILES | CC(O)C(=O)[O-].Cc1nc(=O)c(C#N)cc1-c1ccncc1.[H+] |
| InChI | InChI=1S/C12H9N3O.C3H6O3/c1-8-11(9-2-4-14-5-3-9)6-10(7-13)12(16)15-8;1-2(4)3(5)6/h2-6H,1H3,(H,15,16);2,4H,1H3,(H,5,6) |
| InChIKey | VWUPWEAFIOQCGF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.1.4.17 (3',5'-cyclic-nucleotide phosphodiesterase) inhibitor An EC 3.1.4.* (phosphoric diester hydrolase) inhibitor which interferes with the action of 3',5'-cyclic-nucleotide phosphodiesterase (EC 3.1.4.17). |
| Applications: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. vasodilator agent A drug used to cause dilation of the blood vessels. cardiotonic drug A drug that has a strengthening effect on the heart or that can increase cardiac output. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| milrinone lactate (CHEBI:34850) has part milrinone (CHEBI:50693) |
| milrinone lactate (CHEBI:34850) has role cardiotonic drug (CHEBI:38147) |
| milrinone lactate (CHEBI:34850) has role EC 3.1.4.17 (3',5'-cyclic-nucleotide phosphodiesterase) inhibitor (CHEBI:50568) |
| milrinone lactate (CHEBI:34850) has role platelet aggregation inhibitor (CHEBI:50427) |
| milrinone lactate (CHEBI:34850) has role vasodilator agent (CHEBI:35620) |
| milrinone lactate (CHEBI:34850) is a lactate salt (CHEBI:24997) |
| Synonym | Source |
|---|---|
| Milrinone lactate | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Primacor | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| D02085 | KEGG DRUG |
| DBSALT000891 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:100286-97-3 | ChemIDplus |
| Citations |
|---|