EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18N3O4S.Na |
| Net Charge | 0 |
| Average Mass | 371.394 |
| Monoisotopic Mass | 371.09157 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)[O-])N1C(=O)[C@H]2NC(=O)[C@H](N)c1ccccc1.[Na+] |
| InChI | InChI=1S/C16H19N3O4S.Na/c1-16(2)11(15(22)23)19-13(21)10(14(19)24-16)18-12(20)9(17)8-6-4-3-5-7-8;/h3-7,9-11,14H,17H2,1-2H3,(H,18,20)(H,22,23);/q;+1/p-1/t9-,10-,11+,14-;/m1./s1 |
| InChIKey | KLOHDWPABZXLGI-YWUHCJSESA-M |
| Roles Classification |
|---|
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ampicillin sodium (CHEBI:34535) has part ampicillin(1−) (CHEBI:50658) |
| ampicillin sodium (CHEBI:34535) has role anti-HIV agent (CHEBI:64946) |
| ampicillin sodium (CHEBI:34535) has role antibacterial agent (CHEBI:33282) |
| ampicillin sodium (CHEBI:34535) has role antiinfective agent (CHEBI:35441) |
| ampicillin sodium (CHEBI:34535) has role antimicrobial agent (CHEBI:33281) |
| ampicillin sodium (CHEBI:34535) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 6β-[(2R)-2-amino-2-phenylacetamido]-2,2-dimethylpenam-3α-carboxylate |
| Synonyms | Source |
|---|---|
| Ampicillin (as sodium) | ChEMBL |
| ampicillin natrium | ChemIDplus |
| Ampicillin sodium | KEGG COMPOUND |
| Ampicillin sodium salt | ChEMBL |
| Ampicillin sodium, sterile | ChEMBL |
| Ampicillinum natricum | ChEMBL |
| Brand Names | Source |
|---|---|
| Amp equine | ChEMBL |
| Ampicillin sodium component of unasyn | ChEMBL |
| Austrapen | DrugBank |
| Binotal | DrugBank |
| Omnipen | ChEMBL |
| Omnipen-n | ChEMBL |
| Citations |
|---|