EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:50619 - γ-Glu-Ala
| Formula | C8H14N2O5 |
| Net Charge | 0 |
| Average Mass | 218.209 |
| Monoisotopic Mass | 218.09027 |
| SMILES | C[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C8H14N2O5/c1-4(7(12)13)10-6(11)3-2-5(9)8(14)15/h4-5H,2-3,9H2,1H3,(H,10,11)(H,12,13)(H,14,15)/t4-,5-/m0/s1 |
| InChIKey | WQXXXVRAFAKQJM-WHFBIAKZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Iris (ncbitaxon:26378) | - | PubMed (14213360) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-Glu-Ala (CHEBI:50619) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| γ-Glu-Ala (CHEBI:50619) has role plant metabolite (CHEBI:76924) |
| γ-Glu-Ala (CHEBI:50619) is a γ-glutamylalanine (CHEBI:50621) |
| γ-Glu-Ala (CHEBI:50619) is conjugate acid of γ-Glu-Ala(1−) (CHEBI:133091) |
| Incoming Relation(s) |
| γ-Glu-Ala(1−) (CHEBI:133091) is conjugate base of γ-Glu-Ala (CHEBI:50619) |
| IUPAC Name |
|---|
| L-γ-glutamyl-L-alanine |
| Synonyms | Source |
|---|---|
| 5-L-Glutamyl-L-alanine | ChEBI |
| N-L-γ-glutamyl-L-alanine | ChemIDplus |
| gamma-Glutamylalanine | HMDB |
| gamma-L-Glutamyl-L-alanine | HMDB |
| L-γ-Glu-L-Ala | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0006248 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1728785 | Reaxys |
| CAS:5875-41-2 | ChemIDplus |
| Citations |
|---|