EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H13N2O5 |
| Net Charge | -1 |
| Average Mass | 217.201 |
| Monoisotopic Mass | 217.08300 |
| SMILES | C[C@H](NC(=O)CC[C@H]([NH3+])C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C8H14N2O5/c1-4(7(12)13)10-6(11)3-2-5(9)8(14)15/h4-5H,2-3,9H2,1H3,(H,10,11)(H,12,13)(H,14,15)/p-1/t4-,5-/m0/s1 |
| InChIKey | WQXXXVRAFAKQJM-WHFBIAKZSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Iris (ncbitaxon:26378) | - | PubMed (14213360) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-Glu-Ala(1−) (CHEBI:133091) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| γ-Glu-Ala(1−) (CHEBI:133091) has role plant metabolite (CHEBI:76924) |
| γ-Glu-Ala(1−) (CHEBI:133091) is a peptide anion (CHEBI:60334) |
| γ-Glu-Ala(1−) (CHEBI:133091) is conjugate base of γ-Glu-Ala (CHEBI:50619) |
| Incoming Relation(s) |
| γ-Glu-Ala (CHEBI:50619) is conjugate acid of γ-Glu-Ala(1−) (CHEBI:133091) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-5-{[(1S)-1-carboxylatoethyl]amino}-5-oxopentanoate |
| Synonyms | Source |
|---|---|
| gamma-glutamylalanine | ChEBI |
| L-γ-Glu-L-Ala(1−) | ChEBI |
| L-γ-glutamyl-L-alanine(1−) | ChEBI |
| γ-glutamylalanine(1−) | ChEBI |