EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11N3O2 |
| Net Charge | 0 |
| Average Mass | 169.184 |
| Monoisotopic Mass | 169.08513 |
| SMILES | Cn1cnc(C[C@H](N)C(=O)O)c1 |
| InChI | InChI=1S/C7H11N3O2/c1-10-3-5(9-4-10)2-6(8)7(11)12/h3-4,6H,2,8H2,1H3,(H,11,12)/t6-/m0/s1 |
| InChIKey | BRMWTNUJHUMWMS-LURJTMIESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (23562588) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nτ-methyl-L-histidine (CHEBI:50599) has role human metabolite (CHEBI:77746) |
| Nτ-methyl-L-histidine (CHEBI:50599) is a L-histidine derivative (CHEBI:84076) |
| Nτ-methyl-L-histidine (CHEBI:50599) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| Nτ-methyl-L-histidine (CHEBI:50599) is tautomer of Nτ-methyl-L-histidine zwitterion (CHEBI:192560) |
| Incoming Relation(s) |
| Nτ-methyl-L-histidine residue (CHEBI:16367) is substituent group from Nτ-methyl-L-histidine (CHEBI:50599) |
| Nτ-methyl-L-histidine zwitterion (CHEBI:192560) is tautomer of Nτ-methyl-L-histidine (CHEBI:50599) |
| IUPAC Name |
|---|
| 1-methyl-L-histidine |
| Synonyms | Source |
|---|---|
| 1-methylhistidine | ChemIDplus |
| (2S)-2-amino-3-(1-methyl-1H-imidazol-4-yl)propanoic acid | IUPAC |
| Pi-methylhistidine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000001 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1320034 | Gmelin |
| Beilstein:9727 | Beilstein |
| Reaxys:9727 | Reaxys |
| CAS:332-80-9 | ChemIDplus |
| Citations |
|---|