EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11N3O2 |
| Net Charge | 0 |
| Average Mass | 169.184 |
| Monoisotopic Mass | 169.08513 |
| SMILES | Cn1cnc(C[C@H]([NH3+])C(=O)[O-])c1 |
| InChI | InChI=1S/C7H11N3O2/c1-10-3-5(9-4-10)2-6(8)7(11)12/h3-4,6H,2,8H2,1H3,(H,11,12)/t6-/m0/s1 |
| InChIKey | BRMWTNUJHUMWMS-LURJTMIESA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nτ-methyl-L-histidine zwitterion (CHEBI:192560) is a zwitterion (CHEBI:27369) |
| Nτ-methyl-L-histidine zwitterion (CHEBI:192560) is tautomer of Nτ-methyl-L-histidine (CHEBI:50599) |
| Incoming Relation(s) |
| Nτ-methyl-L-histidine (CHEBI:50599) is tautomer of Nτ-methyl-L-histidine zwitterion (CHEBI:192560) |
| UniProt Name | Source |
|---|---|
| Nτ-methyl-L-histidine | UniProt |
| Citations |
|---|