EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8O2 |
| Net Charge | 0 |
| Average Mass | 124.139 |
| Monoisotopic Mass | 124.05243 |
| SMILES | [H]C(C=C)=C([H])C([H])=C([H])C(=O)O |
| InChI | InChI=1S/C7H8O2/c1-2-3-4-5-6-7(8)9/h2-6H,1H2,(H,8,9) |
| InChIKey | FUCUVXOXNOUYJN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hepta-2,4,6-trienoic acid (CHEBI:50484) is a heptatrienoic acid (CHEBI:50482) |
| hepta-2,4,6-trienoic acid (CHEBI:50484) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| Incoming Relation(s) |
| cis,trans-hepta-2,4,6-trienoic acid (CHEBI:50487) is a hepta-2,4,6-trienoic acid (CHEBI:50484) |
| trans,trans-hepta-2,4,6-trienoic acid (CHEBI:50483) is a hepta-2,4,6-trienoic acid (CHEBI:50484) |
| IUPAC Name |
|---|
| hepta-2,4,6-trienoic acid |