EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H18N2O4 |
| Net Charge | 0 |
| Average Mass | 218.253 |
| Monoisotopic Mass | 218.12666 |
| SMILES | NCCCCCN(O)C(=O)CCC(=O)O |
| InChI | InChI=1S/C9H18N2O4/c10-6-2-1-3-7-11(15)8(12)4-5-9(13)14/h15H,1-7,10H2,(H,13,14) |
| InChIKey | VUXMGAKZQBQIAH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(3-carboxypropanoyl)-N-hydroxycadaverine (CHEBI:50443) is a N-substituted cadaverine (CHEBI:50442) |
| N-(3-carboxypropanoyl)-N-hydroxycadaverine (CHEBI:50443) is tautomer of N-(3-carboxypropanoyl)-N-hydroxycadaverine zwitterion (CHEBI:229778) |
| Incoming Relation(s) |
| bisucaberin B (CHEBI:209443) has functional parent N-(3-carboxypropanoyl)-N-hydroxycadaverine (CHEBI:50443) |
| N-(3-carboxypropanoyl)-N-hydroxycadaverine zwitterion (CHEBI:229778) is tautomer of N-(3-carboxypropanoyl)-N-hydroxycadaverine (CHEBI:50443) |
| IUPAC Name |
|---|
| 4-[(5-aminopentyl)(hydroxy)amino]-4-oxobutanoic acid |
| Synonyms | Source |
|---|---|
| N-hydroxy-N-succinylcadaverine | ChEBI |
| HSC | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5865747 | Beilstein |