EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34N4O7 |
| Net Charge | 0 |
| Average Mass | 418.491 |
| Monoisotopic Mass | 418.24275 |
| SMILES | NCCCCCN(O)C(=O)CCC(=O)NCCCCCN(O)C(=O)CCC(=O)O |
| InChI | InChI=1S/C18H34N4O7/c19-11-3-1-5-13-21(28)16(24)8-7-15(23)20-12-4-2-6-14-22(29)17(25)9-10-18(26)27/h28-29H,1-14,19H2,(H,20,23)(H,26,27) |
| InChIKey | BFOMYWUPLOKASM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tenacibaculum mesophilum (ncbitaxon:104268) | - | PubMed (23549298) |
| Roles Classification |
|---|
| Chemical Roles: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bisucaberin B (CHEBI:209443) has functional parent N-(3-carboxypropanoyl)-N-hydroxycadaverine (CHEBI:50443) |
| bisucaberin B (CHEBI:209443) has role bacterial metabolite (CHEBI:76969) |
| bisucaberin B (CHEBI:209443) has role marine metabolite (CHEBI:76507) |
| bisucaberin B (CHEBI:209443) has role siderophore (CHEBI:26672) |
| bisucaberin B (CHEBI:209443) is a amino monocarboxylic acid (CHEBI:52448) |
| bisucaberin B (CHEBI:209443) is a hydroxamic acid (CHEBI:24650) |
| bisucaberin B (CHEBI:209443) is a primary amino compound (CHEBI:50994) |
| bisucaberin B (CHEBI:209443) is a secondary carboxamide (CHEBI:140325) |
| bisucaberin B (CHEBI:209443) is a tertiary carboxamide (CHEBI:140326) |
| bisucaberin B (CHEBI:209443) is tautomer of bisucaberin B zwitterion (CHEBI:229779) |
| Incoming Relation(s) |
| bisucaberin B zwitterion (CHEBI:229779) is tautomer of bisucaberin B (CHEBI:209443) |
| IUPAC Name |
|---|
| 4-[(5-{4-[(5-aminopentyl)(hydroxy)amino]-4-oxobutanamido}pentyl)(hydroxy)amino]-4-oxobutanoic acid |
| Synonym | Source |
|---|---|
| pre-bisucaberin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 17588243 | ChemSpider |
| Citations |
|---|