EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6O4 |
| Net Charge | 0 |
| Average Mass | 130.099 |
| Monoisotopic Mass | 130.02661 |
| SMILES | O=C(O)/C=C\CC(=O)O |
| InChI | InChI=1S/C5H6O4/c6-4(7)2-1-3-5(8)9/h1-2H,3H2,(H,6,7)(H,8,9)/b2-1- |
| InChIKey | XVOUMQNXTGKGMA-UPHRSURJSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-glutaconic acid (CHEBI:50429) is a glutaconic acid (CHEBI:24309) |
| Incoming Relation(s) |
| (2E)-3-(methoxycarbonyl)pent-2-enedioic acid (CHEBI:15663) has functional parent (Z)-glutaconic acid (CHEBI:50429) |
| Synonym | Source |
|---|---|
| (2Z)-pent-2-enedioic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1722685 | Reaxys |