EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6O4 |
| Net Charge | 0 |
| Average Mass | 130.099 |
| Monoisotopic Mass | 130.02661 |
| SMILES | [H]C(=CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C5H6O4/c6-4(7)2-1-3-5(8)9/h1-2H,3H2,(H,6,7)(H,8,9) |
| InChIKey | XVOUMQNXTGKGMA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (23859237) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glutaconic acid (CHEBI:24309) has role human metabolite (CHEBI:77746) |
| glutaconic acid (CHEBI:24309) is a pentenedioic acid (CHEBI:36129) |
| glutaconic acid (CHEBI:24309) is conjugate acid of glutaconate(1−) (CHEBI:36462) |
| Incoming Relation(s) |
| glutaconyl-CoA (CHEBI:24311) has functional parent glutaconic acid (CHEBI:24309) |
| (E)-glutaconic acid (CHEBI:15670) is a glutaconic acid (CHEBI:24309) |
| (Z)-glutaconic acid (CHEBI:50429) is a glutaconic acid (CHEBI:24309) |
| glutaconate(1−) (CHEBI:36462) is conjugate base of glutaconic acid (CHEBI:24309) |
| IUPAC Name |
|---|
| pent-2-enedioic acid |
| Synonyms | Source |
|---|---|
| 2-Pentenedioic acid | ChemIDplus |
| Glutaconic acid | ChemIDplus |
| Pent-2-ene-1,5-dioic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1759560 | Reaxys |
| CAS:1724-02-3 | ChemIDplus |
| Citations |
|---|