EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H45N3O3 |
| Net Charge | 0 |
| Average Mass | 423.642 |
| Monoisotopic Mass | 423.34609 |
| SMILES | CCN(CC)CCOc1cccc(OCCN(CC)CC)c1OCCN(CC)CC |
| InChI | InChI=1S/C24H45N3O3/c1-7-25(8-2)16-19-28-22-14-13-15-23(29-20-17-26(9-3)10-4)24(22)30-21-18-27(11-5)12-6/h13-15H,7-12,16-21H2,1-6H3 |
| InChIKey | ICLWTJIMXVISSR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. muscle relaxant A drug used to produce muscle relaxation (excepting neuromuscular blocking agents). Its primary clinical and therapeutic use is the treatment of muscle spasm and immobility associated with strains, sprains, and injuries of the back and, to a lesser degree, injuries to the neck. Also used for the treatment of a variety of clinical conditions that have in common only the presence of skeletal muscle hyperactivity, for example, the muscle spasms that can occur in multiple sclerosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gallamine (CHEBI:503442) has role cholinergic antagonist (CHEBI:48873) |
| gallamine (CHEBI:503442) has role drug allergen (CHEBI:88188) |
| gallamine (CHEBI:503442) has role muscle relaxant (CHEBI:51371) |
| gallamine (CHEBI:503442) is a tertiary amine (CHEBI:32876) |
| IUPAC Name |
|---|
| 2,2',2''-[benzene-1,2,3-triyltris(oxy)]tris(N,N-diethylethanamine) |
| Synonyms | Source |
|---|---|
| 2,2',2''-(Benzene-1,2,3-triyltri(oxy))tris(N,N-diethylethylamine) | ChemIDplus |
| 2-(2,6-bis(2-(diethylamino)ethoxy)phenoxy)-N,N-diethylethanamine | ChEMBL |
| Gallamonum | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1893976 | Reaxys |
| CAS:153-76-4 | ChemIDplus |
| Citations |
|---|