EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H20O7P2 |
| Net Charge | 0 |
| Average Mass | 314.211 |
| Monoisotopic Mass | 314.06843 |
| SMILES | C=C(C)C(CC=C(C)C)COP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C10H20O7P2/c1-8(2)5-6-10(9(3)4)7-16-19(14,15)17-18(11,12)13/h5,10H,3,6-7H2,1-2,4H3,(H,14,15)(H2,11,12,13) |
| InChIKey | LHLLBECTIHFNGQ-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lavandulyl diphosphate (CHEBI:50284) has functional parent lavandulol (CHEBI:50281) |
| lavandulyl diphosphate (CHEBI:50284) is a alkyl diphosphate (CHEBI:46731) |
| lavandulyl diphosphate (CHEBI:50284) is conjugate acid of lavandulyl diphosphate(3−) (CHEBI:58820) |
| Incoming Relation(s) |
| (R)-lavandulyl diphosphate (CHEBI:50280) is a lavandulyl diphosphate (CHEBI:50284) |
| lavandulyl diphosphate(3−) (CHEBI:58820) is conjugate base of lavandulyl diphosphate (CHEBI:50284) |
| IUPAC Name |
|---|
| 5-methyl-2-(prop-1-en-2-yl)hex-4-en-1-yl trihydrogen diphosphate |
| Synonym | Source |
|---|---|
| 5-methyl-2-(1-methylethenyl)hex-4-en-1-yl trihydrogen diphosphate | IUPAC |